Products 1260676-52-5
CAS 1260676-52-5 appears in our catalog under these names: 1-(2-Chloro-5-(trifluoromethyl)phenyl)cyclopropane-1-carboxylic acid, 95%, 1-(2-Chloro-5-(trifluoromethyl)phenyl)cyclopropane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (CAS 1260676-52-5) is a chemical compound with the molecular formula C11H8ClF3O2 and a molecular weight of 264.63 g/mol. IUPAC name: 1-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid. InChIKey: GXAINMQIFBFWRP-UHFFFAOYSA-N.
| Molecular formula | C11H8ClF3O2 |
|---|---|
| Molecular weight | 264.63 g/mol |
| IUPAC name | 1-[2-chloro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | GXAINMQIFBFWRP-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=C(C=CC(=C2)C(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)