Products 1260761-44-1

CAS 1260761-44-1 is the registry number for Methyl 2-bromo-3-(4-(trifluoromethyl)phenyl)propanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-bromo-3-[4-(trifluoromethyl)phenyl]propanoate (CAS 1260761-44-1) is a chemical compound with the molecular formula C11H10BrF3O2 and a molecular weight of 311.09 g/mol. IUPAC name: methyl 2-bromo-3-[4-(trifluoromethyl)phenyl]propanoate. InChIKey: LZMQOEJHOIFBEV-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10BrF3O2
Molecular weight311.09 g/mol
IUPAC namemethyl 2-bromo-3-[4-(trifluoromethyl)phenyl]propanoate
InChIKeyLZMQOEJHOIFBEV-UHFFFAOYSA-N
SMILESCOC(=O)C(CC1=CC=C(C=C1)C(F)(F)F)Br

Computed by PubChem (NCBI)