CAS 1260762-36-4 appears in our catalog under these names: 2-(Quinolin-7-yl)ethanol, 95%, 2-(Quinolin-7-yl)ethanol. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
2-quinolin-7-ylethanol (CAS 1260762-36-4) is a chemical compound with the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. IUPAC name: 2-quinolin-7-ylethanol. InChIKey: QSQLGWHAPKFCOG-UHFFFAOYSA-N.
| Molecular formula | C11H11NO |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2-quinolin-7-ylethanol |
| InChIKey | QSQLGWHAPKFCOG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)CCO)N=C1 |
Computed by PubChem (NCBI)