CAS 1260780-99-1 appears in our catalog under these names: 1-(3-Fluoro-5-(trifluoromethyl)phenyl)cyclopropane-1-carboxylic acid, 1-(3-Fluoro-5-(trifluoromethyl)phenyl)cyclopropane-1-carboxylic acid, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-[3-fluoro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid (CAS 1260780-99-1) is a chemical compound with the molecular formula C11H8F4O2 and a molecular weight of 248.17 g/mol. IUPAC name: 1-[3-fluoro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid. InChIKey: UHHHXFUMRLHTJJ-UHFFFAOYSA-N.
| Molecular formula | C11H8F4O2 |
|---|---|
| Molecular weight | 248.17 g/mol |
| IUPAC name | 1-[3-fluoro-5-(trifluoromethyl)phenyl]cyclopropane-1-carboxylic acid |
| InChIKey | UHHHXFUMRLHTJJ-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=CC(=C2)F)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)