CAS 1260787-47-0 appears in our catalog under these names: 6-Bromo-4-chloro-3-iodoquinoline, 95%, 6-Bromo-4-chloro-3-iodoquinoline, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 100mg, 1g.
6-bromo-4-chloro-3-iodoquinoline (CAS 1260787-47-0) is a chemical compound with the molecular formula C9H4BrClIN and a molecular weight of 368.39 g/mol. IUPAC name: 6-bromo-4-chloro-3-iodoquinoline. InChIKey: WWGORJUJIJKUIH-UHFFFAOYSA-N.
| Molecular formula | C9H4BrClIN |
|---|---|
| Molecular weight | 368.39 g/mol |
| IUPAC name | 6-bromo-4-chloro-3-iodoquinoline |
| InChIKey | WWGORJUJIJKUIH-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2C=C1Br)Cl)I |
Computed by PubChem (NCBI)