CAS 1260788-41-7 is the registry number for (4-Chloro-2,5-difluoropyridin-3-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chloro-2,5-difluoro-3-pyridinyl)methanol (CAS 1260788-41-7) is a chemical compound with the molecular formula C6H4ClF2NO and a molecular weight of 179.55 g/mol. IUPAC name: (4-chloro-2,5-difluoro-3-pyridinyl)methanol. InChIKey: HCTMRUWFNVHWNM-UHFFFAOYSA-N.
| Molecular formula | C6H4ClF2NO |
|---|---|
| Molecular weight | 179.55 g/mol |
| IUPAC name | (4-chloro-2,5-difluoro-3-pyridinyl)methanol |
| InChIKey | HCTMRUWFNVHWNM-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)F)CO)Cl)F |
Computed by PubChem (NCBI)