CAS 1260815-69-7 appears in our catalog under these names: 6-Bromo-8-fluoroisoquinolin-3-amine, 95%, 6–Bromo–8–fluoroisoquinolin–3–amine. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
6-bromo-8-fluoroisoquinolin-3-amine (CAS 1260815-69-7) is a chemical compound with the molecular formula C9H6BrFN2 and a molecular weight of 241.06 g/mol. IUPAC name: 6-bromo-8-fluoroisoquinolin-3-amine. InChIKey: JCIBQHVIBLSPME-UHFFFAOYSA-N.
| Molecular formula | C9H6BrFN2 |
|---|---|
| Molecular weight | 241.06 g/mol |
| IUPAC name | 6-bromo-8-fluoroisoquinolin-3-amine |
| InChIKey | JCIBQHVIBLSPME-UHFFFAOYSA-N |
| SMILES | C1=C2C=C(N=CC2=C(C=C1Br)F)N |
Computed by PubChem (NCBI)