Products 1260817-43-3
CAS 1260817-43-3 appears in our catalog under these names: 4-Methoxy-2-(trifluoromethyl)benzyl chloride, 97%, 97%, 4-Methoxy-2-(trifluoromethyl)benzyl chloride, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
1-(chloromethyl)-4-methoxy-2-(trifluoromethyl)benzene (CAS 1260817-43-3) is a chemical compound with the molecular formula C9H8ClF3O and a molecular weight of 224.61 g/mol. IUPAC name: 1-(chloromethyl)-4-methoxy-2-(trifluoromethyl)benzene. InChIKey: XFBKUUQFEIZZQY-UHFFFAOYSA-N.
| Molecular formula | C9H8ClF3O |
|---|---|
| Molecular weight | 224.61 g/mol |
| IUPAC name | 1-(chloromethyl)-4-methoxy-2-(trifluoromethyl)benzene |
| InChIKey | XFBKUUQFEIZZQY-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CCl)C(F)(F)F |
Computed by PubChem (NCBI)