CAS 1260830-11-2 is the registry number for 6-Bromo-7-methyl-1,3-dihydro-indol-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-bromo-7-methyl-1,3-dihydroindol-2-one (CAS 1260830-11-2) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: 6-bromo-7-methyl-1,3-dihydroindol-2-one. InChIKey: CJLUWJSRUMAJCY-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 6-bromo-7-methyl-1,3-dihydroindol-2-one |
| InChIKey | CJLUWJSRUMAJCY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC2=C1NC(=O)C2)Br |
Computed by PubChem (NCBI)