Products 126085-89-0

CAS 126085-89-0 is the registry number for 3-Methyl-5-(tributylstannyl)isoxazole. Offered by: TRC, Biosynth. Available pack sizes: 500mg, 50mg, 100mg, 250mg, 1000mg.

Structural formula: {0} (CAS {1})

Tributyl-(3-methyl-1,2-oxazol-5-yl)stannane (CAS 126085-89-0) is a chemical compound with the molecular formula C16H31NOSn and a molecular weight of 372.1 g/mol. IUPAC name: tributyl-(3-methyl-1,2-oxazol-5-yl)stannane. InChIKey: YYGNJPDQYSBWPH-UHFFFAOYSA-N.

Identity
Molecular formulaC16H31NOSn
Molecular weight372.1 g/mol
IUPAC nametributyl-(3-methyl-1,2-oxazol-5-yl)stannane
InChIKeyYYGNJPDQYSBWPH-UHFFFAOYSA-N
SMILESCCCC[Sn](CCCC)(CCCC)C1=CC(=NO1)C

Computed by PubChem (NCBI)