CAS 1260850-75-6 appears in our catalog under these names: 1-(6-Chloropyrimidin-4-yl)-1H-1,2,4-triazol-3-amine, 92%, 92%, 1-(6-Chloropyrimidin-4-yl)-1H-1,2,4-triazol-3-amine, 90%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(6-chloropyrimidin-4-yl)-1,2,4-triazol-3-amine (CAS 1260850-75-6) is a chemical compound with the molecular formula C6H5ClN6 and a molecular weight of 196.60 g/mol. IUPAC name: 1-(6-chloropyrimidin-4-yl)-1,2,4-triazol-3-amine. InChIKey: XIKSHUKWERTAED-UHFFFAOYSA-N.
| Molecular formula | C6H5ClN6 |
|---|---|
| Molecular weight | 196.60 g/mol |
| IUPAC name | 1-(6-chloropyrimidin-4-yl)-1,2,4-triazol-3-amine |
| InChIKey | XIKSHUKWERTAED-UHFFFAOYSA-N |
| SMILES | C1=C(N=CN=C1Cl)N2C=NC(=N2)N |
Computed by PubChem (NCBI)