CAS 1260851-75-9 appears in our catalog under these names: 6-Bromo-5-methyl-2,3-dihydro-1H-indol-2-one, 98%, 98%, 6-BROMO-5-METHYL-2,3-DIHYDRO-1H-INDOL-2-ONE, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 500mg.
6-bromo-5-methyl-1,3-dihydroindol-2-one (CAS 1260851-75-9) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: 6-bromo-5-methyl-1,3-dihydroindol-2-one. InChIKey: AZELOYIMXKBEDP-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 6-bromo-5-methyl-1,3-dihydroindol-2-one |
| InChIKey | AZELOYIMXKBEDP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1Br)NC(=O)C2 |
Computed by PubChem (NCBI)