CAS 1260876-51-4 appears in our catalog under these names: 1–(tert–Butoxycarbonyl)–3–hydroxypiperidine–4–carboxylic acid, 1-(tert-Butoxycarbonyl)-3-hydroxypiperidine-4-carboxylic acid, 95%, 1,4-Piperidinedicarboxylic acid, 3-hydroxy-, 1-(1,1-dimethylethyl) ester, 95%, 95%. Offered by: GLPBio, Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 500mg.
3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid (CAS 1260876-51-4) is a chemical compound with the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. IUPAC name: 3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid. InChIKey: RIZCQEWQJRFDHL-UHFFFAOYSA-N.
| Molecular formula | C11H19NO5 |
|---|---|
| Molecular weight | 245.27 g/mol |
| IUPAC name | 3-hydroxy-1-[(2-methylpropan-2-yl)oxycarbonyl]piperidine-4-carboxylic acid |
| InChIKey | RIZCQEWQJRFDHL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)O)C(=O)O |
Computed by PubChem (NCBI)