CAS 1260887-38-4 is the registry number for 4-Bromo-7-methyl-2,3-dihydro-1H-indol-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-bromo-7-methyl-1,3-dihydroindol-2-one (CAS 1260887-38-4) is a chemical compound with the molecular formula C9H8BrNO and a molecular weight of 226.07 g/mol. IUPAC name: 4-bromo-7-methyl-1,3-dihydroindol-2-one. InChIKey: TULGNCBFDGDWAV-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO |
|---|---|
| Molecular weight | 226.07 g/mol |
| IUPAC name | 4-bromo-7-methyl-1,3-dihydroindol-2-one |
| InChIKey | TULGNCBFDGDWAV-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=C(C=C1)Br)CC(=O)N2 |
Computed by PubChem (NCBI)