CAS 1260887-85-1 is the registry number for Didemethyl Citalopram Hydrobromide (>85%). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
1-(3-aminopropyl)-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;hydrobromide (CAS 1260887-85-1) is a chemical compound with the molecular formula C18H18BrFN2O and a molecular weight of 377.2 g/mol. IUPAC name: 1-(3-aminopropyl)-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;hydrobromide. InChIKey: HPONIRDZJWMVDD-UHFFFAOYSA-N.
| Molecular formula | C18H18BrFN2O |
|---|---|
| Molecular weight | 377.2 g/mol |
| IUPAC name | 1-(3-aminopropyl)-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;hydrobromide |
| InChIKey | HPONIRDZJWMVDD-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)C#N)C(O1)(CCCN)C3=CC=C(C=C3)F.Br |
Computed by PubChem (NCBI)