CAS 1260898-57-4 is the registry number for t-Butyl 4-(3-bromo-2-cyanophenyl)piperazine-1-carboxylate, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 4-(3-bromo-2-cyanophenyl)piperazine-1-carboxylate (CAS 1260898-57-4) is a chemical compound with the molecular formula C16H20BrN3O2 and a molecular weight of 366.25 g/mol. IUPAC name: tert-butyl 4-(3-bromo-2-cyanophenyl)piperazine-1-carboxylate. InChIKey: JIAQPOMQFNJYDQ-UHFFFAOYSA-N.
| Molecular formula | C16H20BrN3O2 |
|---|---|
| Molecular weight | 366.25 g/mol |
| IUPAC name | tert-butyl 4-(3-bromo-2-cyanophenyl)piperazine-1-carboxylate |
| InChIKey | JIAQPOMQFNJYDQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=C(C(=CC=C2)Br)C#N |
Computed by PubChem (NCBI)