CAS 12609-80-2 appears in our catalog under these names: DEAE-Sephadex A-25 Chloride, DEAE SEPHADEX, DEAE Cross-linked dextran A 25. Offered by: TRC, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1g, 2,5g, 5g, 10G, 50G, 1 g, 500 mg.
Sodium 4-(pyridin-2-yldiazenyl)benzene-1,3-diol (CAS 12609-80-2) is a chemical compound with the molecular formula C11H9N3NaO2+ and a molecular weight of 238.20 g/mol. IUPAC name: sodium 4-(pyridin-2-yldiazenyl)benzene-1,3-diol. InChIKey: KZRPHCQLJZXMJV-UHFFFAOYSA-N.
| Molecular formula | C11H9N3NaO2+ |
|---|---|
| Molecular weight | 238.20 g/mol |
| IUPAC name | sodium 4-(pyridin-2-yldiazenyl)benzene-1,3-diol |
| InChIKey | KZRPHCQLJZXMJV-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)N=NC2=C(C=C(C=C2)O)O.[Na+] |
Computed by PubChem (NCBI)