CAS 1260945-67-2 is the registry number for Ethyl 1-(4-fluorophenyl)-3-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrido[2,3-d]pyrimidine-6-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
Ethyl 1-(4-fluorophenyl)-3-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate (CAS 1260945-67-2) is a chemical compound with the molecular formula C17H14FN3O4 and a molecular weight of 343.31 g/mol. IUPAC name: ethyl 1-(4-fluorophenyl)-3-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate. InChIKey: MIIFASRJBAABQC-UHFFFAOYSA-N.
| Molecular formula | C17H14FN3O4 |
|---|---|
| Molecular weight | 343.31 g/mol |
| IUPAC name | ethyl 1-(4-fluorophenyl)-3-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate |
| InChIKey | MIIFASRJBAABQC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N=C1)N(C(=O)N(C2=O)C)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)