CAS 1260983-12-7 is the registry number for (S)-3,3,3-Trifluoro-2-methylpropane-1,2-diamine dihydrochloride, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-3,3,3-trifluoro-2-methylpropane-1,2-diamine;dihydrochloride (CAS 1260983-12-7) is a chemical compound with the molecular formula C4H11Cl2F3N2 and a molecular weight of 215.04 g/mol. IUPAC name: (2S)-3,3,3-trifluoro-2-methylpropane-1,2-diamine;dihydrochloride. InChIKey: KWMYVYLOVZVYNV-QTNFYWBSSA-N.
| Molecular formula | C4H11Cl2F3N2 |
|---|---|
| Molecular weight | 215.04 g/mol |
| IUPAC name | (2S)-3,3,3-trifluoro-2-methylpropane-1,2-diamine;dihydrochloride |
| InChIKey | KWMYVYLOVZVYNV-QTNFYWBSSA-N |
| SMILES | C[C@](CN)(C(F)(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)