CAS 1261170-79-9 appears in our catalog under these names: m-Coumaric acid-13C3, 98% +98%atom%13C, m-Coumaric acid-13C3. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 5mg, 25mg, 10mg.
(E)-3-(3-hydroxyphenyl)(1,2,3-13C3)prop-2-enoic acid (CAS 1261170-79-9) is a chemical compound with the molecular formula C9H8O3 and a molecular weight of 167.14 g/mol. IUPAC name: (E)-3-(3-hydroxyphenyl)(1,2,3-13C3)prop-2-enoic acid. InChIKey: KKSDGJDHHZEWEP-HYKTYXKDSA-N.
| Molecular formula | C9H8O3 |
|---|---|
| Molecular weight | 167.14 g/mol |
| IUPAC name | (E)-3-(3-hydroxyphenyl)(1,2,3-13C3)prop-2-enoic acid |
| InChIKey | KKSDGJDHHZEWEP-HYKTYXKDSA-N |
| SMILES | C1=CC(=CC(=C1)O)/[13CH]=[13CH]/[13C](=O)O |
Computed by PubChem (NCBI)