CAS 1261170-82-4 appears in our catalog under these names: 1H-1,2,4-Triazole-3,5-13C2-1,2,4-15N3, 98% 98%atom%13C,98%atom%15N, 1H-1,2,4-Triazole-3,5-13C2-1,2,4-15N3, 1,2,4-Triazole-13C2,15N3. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 25mg, 500 μg, 100 μg, 1 mg.
(3,5-13C2,1,2,4-15N3)1H-1,2,4-triazole (CAS 1261170-82-4) is a chemical compound with the molecular formula C2H3N3 and a molecular weight of 74.031 g/mol. IUPAC name: (3,5-13C2,1,2,4-15N3)1H-1,2,4-triazole. InChIKey: NSPMIYGKQJPBQR-CVMUNTFWSA-N.
| Molecular formula | C2H3N3 |
|---|---|
| Molecular weight | 74.031 g/mol |
| IUPAC name | (3,5-13C2,1,2,4-15N3)1H-1,2,4-triazole |
| InChIKey | NSPMIYGKQJPBQR-CVMUNTFWSA-N |
| SMILES | [13CH]1=[15N][13CH]=[15N][15NH]1 |
Computed by PubChem (NCBI)