CAS 1261170-87-9 appears in our catalog under these names: 2-Iodoaniline-13C6, 98% +98%atom%13C, 2-Iodoaniline-13C6. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 5mg, 1mg.
6-iodo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine (CAS 1261170-87-9) is a chemical compound with the molecular formula C6H6IN and a molecular weight of 224.979 g/mol. IUPAC name: 6-iodo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine. InChIKey: UBPDKIDWEADHPP-IDEBNGHGSA-N.
| Molecular formula | C6H6IN |
|---|---|
| Molecular weight | 224.979 g/mol |
| IUPAC name | 6-iodo(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-amine |
| InChIKey | UBPDKIDWEADHPP-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13C](=[13CH]1)N)I |
Computed by PubChem (NCBI)