Products 1261266-23-2
CAS 1261266-23-2 is the registry number for 11β-HSD1-IN-25. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2E,5E)-2,5-bis[[2-fluoro-6-(trifluoromethyl)phenyl]methylidene]cyclopentan-1-one (CAS 1261266-23-2) is a chemical compound with the molecular formula C21H12F8O and a molecular weight of 432.3 g/mol. IUPAC name: (2E,5E)-2,5-bis[[2-fluoro-6-(trifluoromethyl)phenyl]methylidene]cyclopentan-1-one. InChIKey: WOCGWUAYELXILT-WGDLNXRISA-N.
| Molecular formula | C21H12F8O |
|---|---|
| Molecular weight | 432.3 g/mol |
| IUPAC name | (2E,5E)-2,5-bis[[2-fluoro-6-(trifluoromethyl)phenyl]methylidene]cyclopentan-1-one |
| InChIKey | WOCGWUAYELXILT-WGDLNXRISA-N |
| SMILES | C1/C(=C\C2=C(C=CC=C2F)C(F)(F)F)/C(=O)/C(=C/C3=C(C=CC=C3F)C(F)(F)F)/C1 |
Computed by PubChem (NCBI)