CAS 1261289-04-6 appears in our catalog under these names: O-304, 95%, O-304, O–304, O-304 99%, 4-Chloro-N-[2-[(4-chlorophenyl)methyl]-2,3-dihydro-3-oxo-1,2,4-thiadiazol-5-yl]benzamide, 99%, 99%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 100mg, 1g, 1mg, 2mg, 5mg, 10mg, 25mg.
4-chloro-N-[2-[(4-chlorophenyl)methyl]-3-oxo-1,2,4-thiadiazol-5-yl]benzamide (CAS 1261289-04-6) is a chemical compound with the molecular formula C16H11Cl2N3O2S and a molecular weight of 380.2 g/mol. IUPAC name: 4-chloro-N-[2-[(4-chlorophenyl)methyl]-3-oxo-1,2,4-thiadiazol-5-yl]benzamide. InChIKey: WEDWLYRQKUTOAX-UHFFFAOYSA-N.
| Molecular formula | C16H11Cl2N3O2S |
|---|---|
| Molecular weight | 380.2 g/mol |
| IUPAC name | 4-chloro-N-[2-[(4-chlorophenyl)methyl]-3-oxo-1,2,4-thiadiazol-5-yl]benzamide |
| InChIKey | WEDWLYRQKUTOAX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN2C(=O)N=C(S2)NC(=O)C3=CC=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)