CAS 1261365-51-8 is the registry number for 3-Iodo-5-(trifluoromethyl)pyridin-2-yl trifluoromethanesulfonate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[3-iodo-5-(trifluoromethyl)-2-pyridinyl] trifluoromethanesulfonate (CAS 1261365-51-8) is a chemical compound with the molecular formula C7H2F6INO3S and a molecular weight of 421.06 g/mol. IUPAC name: [3-iodo-5-(trifluoromethyl)-2-pyridinyl] trifluoromethanesulfonate. InChIKey: AIZAOBDXVQHJDQ-UHFFFAOYSA-N.
| Molecular formula | C7H2F6INO3S |
|---|---|
| Molecular weight | 421.06 g/mol |
| IUPAC name | [3-iodo-5-(trifluoromethyl)-2-pyridinyl] trifluoromethanesulfonate |
| InChIKey | AIZAOBDXVQHJDQ-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1I)OS(=O)(=O)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)