CAS 1261365-55-2 is the registry number for 4-Iodo-1,5-naphthyridin-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-iodo-1,5-naphthyridin-3-amine (CAS 1261365-55-2) is a chemical compound with the molecular formula C8H6IN3 and a molecular weight of 271.06 g/mol. IUPAC name: 4-iodo-1,5-naphthyridin-3-amine. InChIKey: JVBCOKNQHUKGGS-UHFFFAOYSA-N.
| Molecular formula | C8H6IN3 |
|---|---|
| Molecular weight | 271.06 g/mol |
| IUPAC name | 4-iodo-1,5-naphthyridin-3-amine |
| InChIKey | JVBCOKNQHUKGGS-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC=C(C(=C2N=C1)I)N |
Computed by PubChem (NCBI)