CAS 1261365-59-6 is the registry number for 5-(Trifluoromethyl)-4-(trimethylsilyl)-1h-pyrrolo[2,3-b]pyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Trimethyl-[5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]silane (CAS 1261365-59-6) is a chemical compound with the molecular formula C11H13F3N2Si and a molecular weight of 258.31 g/mol. IUPAC name: trimethyl-[5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]silane. InChIKey: FNUJUBLSTKUWMI-UHFFFAOYSA-N.
| Molecular formula | C11H13F3N2Si |
|---|---|
| Molecular weight | 258.31 g/mol |
| IUPAC name | trimethyl-[5-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridin-4-yl]silane |
| InChIKey | FNUJUBLSTKUWMI-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=C2C=CNC2=NC=C1C(F)(F)F |
Computed by PubChem (NCBI)