CAS 1261396-21-7 appears in our catalog under these names: Mitotane-13C6, >95% (HPLC), Mitotane-13C6, Mitotane-13C6, 98.62%. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 1 mg.
1-chloro-2-[2,2-dichloro-1-(4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)ethyl]benzene (CAS 1261396-21-7) is a chemical compound with the molecular formula C14H10Cl4 and a molecular weight of 326.0 g/mol. IUPAC name: 1-chloro-2-[2,2-dichloro-1-(4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)ethyl]benzene. InChIKey: JWBOIMRXGHLCPP-CYRQOIGNSA-N.
| Molecular formula | C14H10Cl4 |
|---|---|
| Molecular weight | 326.0 g/mol |
| IUPAC name | 1-chloro-2-[2,2-dichloro-1-(4-chloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)ethyl]benzene |
| InChIKey | JWBOIMRXGHLCPP-CYRQOIGNSA-N |
| SMILES | C1=CC=C(C(=C1)C([13C]2=[13CH][13CH]=[13C]([13CH]=[13CH]2)Cl)C(Cl)Cl)Cl |
Computed by PubChem (NCBI)