Products 1261454-22-1

CAS 1261454-22-1 appears in our catalog under these names: 5-Fluoro-2-hydroxybenzene-1-sulfonyl chloride, 5-Fluoro-2-hydroxybenzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.

5-fluoro-2-hydroxybenzenesulfonyl chloride (CAS 1261454-22-1) is a chemical compound with the molecular formula C6H4ClFO3S and a molecular weight of 210.61 g/mol. IUPAC name: 5-fluoro-2-hydroxybenzenesulfonyl chloride. InChIKey: PHTGHCYXJUBHHN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4ClFO3S
Molecular weight210.61 g/mol
IUPAC name5-fluoro-2-hydroxybenzenesulfonyl chloride
InChIKeyPHTGHCYXJUBHHN-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1F)S(=O)(=O)Cl)O

Computed by PubChem (NCBI)