CAS 1261454-39-0 appears in our catalog under these names: 7-Chloro-1-naphthonitrile, 95+%, 7-Chloronaphthalene-1-carbonitrile. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-chloronaphthalene-1-carbonitrile (CAS 1261454-39-0) is a chemical compound with the molecular formula C11H6ClN and a molecular weight of 187.62 g/mol. IUPAC name: 7-chloronaphthalene-1-carbonitrile. InChIKey: PSUSJPAEWLGIKT-UHFFFAOYSA-N.
| Molecular formula | C11H6ClN |
|---|---|
| Molecular weight | 187.62 g/mol |
| IUPAC name | 7-chloronaphthalene-1-carbonitrile |
| InChIKey | PSUSJPAEWLGIKT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=C2)Cl)C(=C1)C#N |
Computed by PubChem (NCBI)