CAS 1261468-45-4 is the registry number for 2-(Difluoromethyl)-6-methoxynaphthalene, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(difluoromethyl)-6-methoxynaphthalene (CAS 1261468-45-4) is a chemical compound with the molecular formula C12H10F2O and a molecular weight of 208.20 g/mol. IUPAC name: 2-(difluoromethyl)-6-methoxynaphthalene. InChIKey: SGGZONFBOIHTNV-UHFFFAOYSA-N.
| Molecular formula | C12H10F2O |
|---|---|
| Molecular weight | 208.20 g/mol |
| IUPAC name | 2-(difluoromethyl)-6-methoxynaphthalene |
| InChIKey | SGGZONFBOIHTNV-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C=C2)C(F)F |
Computed by PubChem (NCBI)