Products 1261498-12-7

CAS 1261498-12-7 is the registry number for 2-Bromo-6-iodobenzyl bromide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

1-bromo-2-(bromomethyl)-3-iodobenzene (CAS 1261498-12-7) is a chemical compound with the molecular formula C7H5Br2I and a molecular weight of 375.83 g/mol. IUPAC name: 1-bromo-2-(bromomethyl)-3-iodobenzene. InChIKey: LUUACGYKFNXCSS-UHFFFAOYSA-N.

Identity
Molecular formulaC7H5Br2I
Molecular weight375.83 g/mol
IUPAC name1-bromo-2-(bromomethyl)-3-iodobenzene
InChIKeyLUUACGYKFNXCSS-UHFFFAOYSA-N
SMILESC1=CC(=C(C(=C1)I)CBr)Br

Computed by PubChem (NCBI)