CAS 1261570-58-4 appears in our catalog under these names: 2-Chloro-3-methylbenzenesulfonamide, 97%, 2-Chloro-3-methylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-chloro-3-methylbenzenesulfonamide (CAS 1261570-58-4) is a chemical compound with the molecular formula C7H8ClNO2S and a molecular weight of 205.66 g/mol. IUPAC name: 2-chloro-3-methylbenzenesulfonamide. InChIKey: VWNXFYAFLZCBSS-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO2S |
|---|---|
| Molecular weight | 205.66 g/mol |
| IUPAC name | 2-chloro-3-methylbenzenesulfonamide |
| InChIKey | VWNXFYAFLZCBSS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)S(=O)(=O)N)Cl |
Computed by PubChem (NCBI)