Products 1261588-73-1
CAS 1261588-73-1 appears in our catalog under these names: 3,3'-Bis(trifluoromethoxy)-1,1'-biphenyl, >98.0%(GC), 1,1′-Biphenyl, 3,3′-bis(trifluoromethoxy)-, 98.0%. Offered by: TCI, Chemat. Available pack sizes: 1g, 10g.
1-(trifluoromethoxy)-3-[3-(trifluoromethoxy)phenyl]benzene (CAS 1261588-73-1) is a chemical compound with the molecular formula C14H8F6O2 and a molecular weight of 322.20 g/mol. IUPAC name: 1-(trifluoromethoxy)-3-[3-(trifluoromethoxy)phenyl]benzene. InChIKey: YFTGRZXQPJKNIL-UHFFFAOYSA-N.
| Molecular formula | C14H8F6O2 |
|---|---|
| Molecular weight | 322.20 g/mol |
| IUPAC name | 1-(trifluoromethoxy)-3-[3-(trifluoromethoxy)phenyl]benzene |
| InChIKey | YFTGRZXQPJKNIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)C2=CC(=CC=C2)OC(F)(F)F |
Computed by PubChem (NCBI)