Products 1261635-51-1

CAS 1261635-51-1 is the registry number for 2-Iodo-4,5-dimethylthiophene-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 500mg.

Structural formula: {0} (CAS {1})

2-iodo-4,5-dimethylthiophene-3-carboxylic acid (CAS 1261635-51-1) is a chemical compound with the molecular formula C7H7IO2S and a molecular weight of 282.10 g/mol. IUPAC name: 2-iodo-4,5-dimethylthiophene-3-carboxylic acid. InChIKey: ZJTSQLIZQRJASW-UHFFFAOYSA-N.

Identity
Molecular formulaC7H7IO2S
Molecular weight282.10 g/mol
IUPAC name2-iodo-4,5-dimethylthiophene-3-carboxylic acid
InChIKeyZJTSQLIZQRJASW-UHFFFAOYSA-N
SMILESCC1=C(SC(=C1C(=O)O)I)C

Computed by PubChem (NCBI)