CAS 1261805-72-4 is the registry number for 4-(2-Amino-3-fluorobenzoyl)pyridine. Offered by: Biosynth. Available pack sizes: 250mg.
3-(4-bromophenyl)-1-(2-methoxyphenyl)pyrazole-5-carboxylic acid (CAS 1261805-72-4) is a chemical compound with the molecular formula C17H13BrN2O3 and a molecular weight of 373.2 g/mol. IUPAC name: 3-(4-bromophenyl)-1-(2-methoxyphenyl)pyrazole-5-carboxylic acid. InChIKey: ZBGCAJXQUPDINR-UHFFFAOYSA-N.
| Molecular formula | C17H13BrN2O3 |
|---|---|
| Molecular weight | 373.2 g/mol |
| IUPAC name | 3-(4-bromophenyl)-1-(2-methoxyphenyl)pyrazole-5-carboxylic acid |
| InChIKey | ZBGCAJXQUPDINR-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1N2C(=CC(=N2)C3=CC=C(C=C3)Br)C(=O)O |
Computed by PubChem (NCBI)