CAS 1261844-48-7 appears in our catalog under these names: 2-Difluoromethyl-7-azaindole, 97%, 2-(Difluoromethyl)-1h-pyrrolo[2,3-b]pyridine, 95%, 2-(difluoromethyl)-1H-pyrrolo[2,3-b]pyridine, 97%, 97%, 2-(DIFLUOROMETHYL)-1H-PYRROLO[2,3-B]PYRIDINE, 97%. Offered by: AmBeed, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 500mg.
2-(difluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1261844-48-7) is a chemical compound with the molecular formula C8H6F2N2 and a molecular weight of 168.14 g/mol. IUPAC name: 2-(difluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: CSQUQRRHDBLZMH-UHFFFAOYSA-N.
| Molecular formula | C8H6F2N2 |
|---|---|
| Molecular weight | 168.14 g/mol |
| IUPAC name | 2-(difluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | CSQUQRRHDBLZMH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(NC(=C2)C(F)F)N=C1 |
Computed by PubChem (NCBI)