CAS 1261878-50-5 is the registry number for 5-Fluoro-4'-(trifluoromethyl)biphenyl-2-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-fluoro-2-[4-(trifluoromethyl)phenyl]benzonitrile (CAS 1261878-50-5) is a chemical compound with the molecular formula C14H7F4N and a molecular weight of 265.20 g/mol. IUPAC name: 4-fluoro-2-[4-(trifluoromethyl)phenyl]benzonitrile. InChIKey: RSIRFPUITVYIFS-UHFFFAOYSA-N.
| Molecular formula | C14H7F4N |
|---|---|
| Molecular weight | 265.20 g/mol |
| IUPAC name | 4-fluoro-2-[4-(trifluoromethyl)phenyl]benzonitrile |
| InChIKey | RSIRFPUITVYIFS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(C=CC(=C2)F)C#N)C(F)(F)F |
Computed by PubChem (NCBI)