Products 1261883-41-3

CAS 1261883-41-3 is the registry number for 5,6-Dibromopyridine-3-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

5,6-dibromopyridine-3-sulfonyl chloride (CAS 1261883-41-3) is a chemical compound with the molecular formula C5H2Br2ClNO2S and a molecular weight of 335.40 g/mol. IUPAC name: 5,6-dibromopyridine-3-sulfonyl chloride. InChIKey: RWBLLEANUSWWBE-UHFFFAOYSA-N.

Identity
Molecular formulaC5H2Br2ClNO2S
Molecular weight335.40 g/mol
IUPAC name5,6-dibromopyridine-3-sulfonyl chloride
InChIKeyRWBLLEANUSWWBE-UHFFFAOYSA-N
SMILESC1=C(C=NC(=C1Br)Br)S(=O)(=O)Cl

Computed by PubChem (NCBI)