CAS 1261883-41-3 is the registry number for 5,6-Dibromopyridine-3-sulfonyl chloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5,6-dibromopyridine-3-sulfonyl chloride (CAS 1261883-41-3) is a chemical compound with the molecular formula C5H2Br2ClNO2S and a molecular weight of 335.40 g/mol. IUPAC name: 5,6-dibromopyridine-3-sulfonyl chloride. InChIKey: RWBLLEANUSWWBE-UHFFFAOYSA-N.
| Molecular formula | C5H2Br2ClNO2S |
|---|---|
| Molecular weight | 335.40 g/mol |
| IUPAC name | 5,6-dibromopyridine-3-sulfonyl chloride |
| InChIKey | RWBLLEANUSWWBE-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Br)Br)S(=O)(=O)Cl |
Computed by PubChem (NCBI)