CAS 1261891-04-6 is the registry number for 4-(2,4-Dichlorophenyl)-2-fluorophenol, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(2,4-dichlorophenyl)-2-fluorophenol (CAS 1261891-04-6) is a chemical compound with the molecular formula C12H7Cl2FO and a molecular weight of 257.08 g/mol. IUPAC name: 4-(2,4-dichlorophenyl)-2-fluorophenol. InChIKey: PBUGWWVOYDZJLV-UHFFFAOYSA-N.
| Molecular formula | C12H7Cl2FO |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | 4-(2,4-dichlorophenyl)-2-fluorophenol |
| InChIKey | PBUGWWVOYDZJLV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=C(C=C(C=C2)Cl)Cl)F)O |
Computed by PubChem (NCBI)