Products 1261893-13-3

CAS 1261893-13-3 is the registry number for 2-Chloro-4-(3-fluoro-4-methylphenyl)benzoic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-chloro-4-(3-fluoro-4-methylphenyl)benzoic acid (CAS 1261893-13-3) is a chemical compound with the molecular formula C14H10ClFO2 and a molecular weight of 264.68 g/mol. IUPAC name: 2-chloro-4-(3-fluoro-4-methylphenyl)benzoic acid. InChIKey: XUTAVZFTNYZTEU-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10ClFO2
Molecular weight264.68 g/mol
IUPAC name2-chloro-4-(3-fluoro-4-methylphenyl)benzoic acid
InChIKeyXUTAVZFTNYZTEU-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)C2=CC(=C(C=C2)C(=O)O)Cl)F

Computed by PubChem (NCBI)