CAS 126192-88-9 is the registry number for Norfloxacin Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2-nitrophenyl)-N-[(2-nitrophenyl)-[(2-nitrophenyl)methylideneamino]methyl]methanimine (CAS 126192-88-9) is a chemical compound with the molecular formula C21H15N5O6 and a molecular weight of 433.4 g/mol. IUPAC name: 1-(2-nitrophenyl)-N-[(2-nitrophenyl)-[(2-nitrophenyl)methylideneamino]methyl]methanimine. InChIKey: UFKZLUSJYMJIFQ-UHFFFAOYSA-N.
| Molecular formula | C21H15N5O6 |
|---|---|
| Molecular weight | 433.4 g/mol |
| IUPAC name | 1-(2-nitrophenyl)-N-[(2-nitrophenyl)-[(2-nitrophenyl)methylideneamino]methyl]methanimine |
| InChIKey | UFKZLUSJYMJIFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=NC(C2=CC=CC=C2[N+](=O)[O-])N=CC3=CC=CC=C3[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)