CAS 1261942-55-5 appears in our catalog under these names: 2-(2,5-Difluorophenyl)-4-nitrobenzoic acid, 2-(2,5-difluorophenyl)-4-nitro-benzoic acid, 97%, 97%. Offered by: Biosynth, Chemat. Available pack sizes: 250mg, 100mg, 500mg, 2000mg, 1000mg, 1g.
2-(2,5-difluorophenyl)-4-nitrobenzoic acid (CAS 1261942-55-5) is a chemical compound with the molecular formula C13H7F2NO4 and a molecular weight of 279.19 g/mol. IUPAC name: 2-(2,5-difluorophenyl)-4-nitrobenzoic acid. InChIKey: HLEPVGRBHNJAAF-UHFFFAOYSA-N.
| Molecular formula | C13H7F2NO4 |
|---|---|
| Molecular weight | 279.19 g/mol |
| IUPAC name | 2-(2,5-difluorophenyl)-4-nitrobenzoic acid |
| InChIKey | HLEPVGRBHNJAAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])C2=C(C=CC(=C2)F)F)C(=O)O |
Computed by PubChem (NCBI)