CAS 1261956-26-6 is the registry number for Dimethyl 2-(5-chloro-3-nitropyridin-2-yl)malonate, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
Dimethyl 2-(5-chloro-3-nitro-2-pyridinyl)propanedioate (CAS 1261956-26-6) is a chemical compound with the molecular formula C10H9ClN2O6 and a molecular weight of 288.64 g/mol. IUPAC name: dimethyl 2-(5-chloro-3-nitro-2-pyridinyl)propanedioate. InChIKey: UVSRKEGGVVTQFK-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O6 |
|---|---|
| Molecular weight | 288.64 g/mol |
| IUPAC name | dimethyl 2-(5-chloro-3-nitro-2-pyridinyl)propanedioate |
| InChIKey | UVSRKEGGVVTQFK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=C(C=N1)Cl)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)