Products 1261956-28-8

CAS 1261956-28-8 is the registry number for 4-(4-Fluoro-2-hydroxyphenyl)-3-hydroxybenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

4-(4-fluoro-2-hydroxyphenyl)-3-hydroxybenzoic acid (CAS 1261956-28-8) is a chemical compound with the molecular formula C13H9FO4 and a molecular weight of 248.21 g/mol. IUPAC name: 4-(4-fluoro-2-hydroxyphenyl)-3-hydroxybenzoic acid. InChIKey: NTWLLIMQLCBEPS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H9FO4
Molecular weight248.21 g/mol
IUPAC name4-(4-fluoro-2-hydroxyphenyl)-3-hydroxybenzoic acid
InChIKeyNTWLLIMQLCBEPS-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1C(=O)O)O)C2=C(C=C(C=C2)F)O

Computed by PubChem (NCBI)