CAS 1261957-92-9 is the registry number for 3-(4-Fluoro-3-methoxyphenyl)phenol, 96%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
3-(4-fluoro-3-methoxyphenyl)phenol (CAS 1261957-92-9) is a chemical compound with the molecular formula C13H11FO2 and a molecular weight of 218.22 g/mol. IUPAC name: 3-(4-fluoro-3-methoxyphenyl)phenol. InChIKey: HOYODJWNWJVBCN-UHFFFAOYSA-N.
| Molecular formula | C13H11FO2 |
|---|---|
| Molecular weight | 218.22 g/mol |
| IUPAC name | 3-(4-fluoro-3-methoxyphenyl)phenol |
| InChIKey | HOYODJWNWJVBCN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C2=CC(=CC=C2)O)F |
Computed by PubChem (NCBI)