Products 1261960-97-7

CAS 1261960-97-7 is the registry number for 3-(4-Formylphenyl)-5-trifluoromethylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

3-(4-formylphenyl)-5-(trifluoromethyl)benzoic acid (CAS 1261960-97-7) is a chemical compound with the molecular formula C15H9F3O3 and a molecular weight of 294.22 g/mol. IUPAC name: 3-(4-formylphenyl)-5-(trifluoromethyl)benzoic acid. InChIKey: YDKKMWLRNXCCMN-UHFFFAOYSA-N.

Identity
Molecular formulaC15H9F3O3
Molecular weight294.22 g/mol
IUPAC name3-(4-formylphenyl)-5-(trifluoromethyl)benzoic acid
InChIKeyYDKKMWLRNXCCMN-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1C=O)C2=CC(=CC(=C2)C(F)(F)F)C(=O)O

Computed by PubChem (NCBI)