CAS 1261964-12-8 is the registry number for 5'-Bromo-4-fluoro(1,1'-biphenyl)-2,3'-diol. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
2-(3-bromo-5-hydroxyphenyl)-5-fluorophenol (CAS 1261964-12-8) is a chemical compound with the molecular formula C12H8BrFO2 and a molecular weight of 283.09 g/mol. IUPAC name: 2-(3-bromo-5-hydroxyphenyl)-5-fluorophenol. InChIKey: XZROWWZLYBSMLL-UHFFFAOYSA-N.
| Molecular formula | C12H8BrFO2 |
|---|---|
| Molecular weight | 283.09 g/mol |
| IUPAC name | 2-(3-bromo-5-hydroxyphenyl)-5-fluorophenol |
| InChIKey | XZROWWZLYBSMLL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)O)C2=CC(=CC(=C2)Br)O |
Computed by PubChem (NCBI)