CAS 1261965-22-3 appears in our catalog under these names: 5-[4-(Piperidin-1-ylsulfonyl)phenyl]-3-trifluoromethylphenol, 95%, 4'-(Piperidin-1-ylsulfonyl)-5-(trifluoromethyl)-(1,1'-biphenyl)-3-ol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-(4-piperidin-1-ylsulfonylphenyl)-5-(trifluoromethyl)phenol (CAS 1261965-22-3) is a chemical compound with the molecular formula C18H18F3NO3S and a molecular weight of 385.4 g/mol. IUPAC name: 3-(4-piperidin-1-ylsulfonylphenyl)-5-(trifluoromethyl)phenol. InChIKey: BCSDLXSFXKUXQV-UHFFFAOYSA-N.
| Molecular formula | C18H18F3NO3S |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | 3-(4-piperidin-1-ylsulfonylphenyl)-5-(trifluoromethyl)phenol |
| InChIKey | BCSDLXSFXKUXQV-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)S(=O)(=O)C2=CC=C(C=C2)C3=CC(=CC(=C3)O)C(F)(F)F |
Computed by PubChem (NCBI)