CAS 1261969-58-7 appears in our catalog under these names: 3-Chloro-5-(2-fluorophenyl)phenol, 97%, 5-Chloro-2'-fluoro-(1,1'-biphenyl)-3-ol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
3-chloro-5-(2-fluorophenyl)phenol (CAS 1261969-58-7) is a chemical compound with the molecular formula C12H8ClFO and a molecular weight of 222.64 g/mol. IUPAC name: 3-chloro-5-(2-fluorophenyl)phenol. InChIKey: VDHDZHOOPKAUOP-UHFFFAOYSA-N.
| Molecular formula | C12H8ClFO |
|---|---|
| Molecular weight | 222.64 g/mol |
| IUPAC name | 3-chloro-5-(2-fluorophenyl)phenol |
| InChIKey | VDHDZHOOPKAUOP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC(=CC(=C2)Cl)O)F |
Computed by PubChem (NCBI)